C26H28N4O3 — CID 110064323
15-(2,4-dimethylpyrimidine-5-carbonyl)-3-methyl-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one (PubChem CID 110064323) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 15-(2,4-dimethylpyrimidine-5-carbonyl)-3-methyl-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one.
| Compound Name | 15-(2,4-dimethylpyrimidine-5-carbonyl)-3-methyl-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one |
|---|---|
| PubChem CID | 110064323 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 15-(2,4-dimethylpyrimidine-5-carbonyl)-3-methyl-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one |
| SMILES | Cc1ncc(C(=O)N2CCCOc3ccccc3C(=O)N(C)Cc3cccc(c3)C2)c(C)n1 |
| InChI | InChI=1S/C26H28N4O3/c1-18-23(15-27-19(2)28-18)26(32)30-12-7-13-33-24-11-5-4-10-22(24)25(31)29(3)16-20-8-6-9-21(14-20)17-30/h4-6,8-11,14-15H,7,12-13,16-17H2,1-3H3 |
| InChIKey | HVGZIHPRGPGXHJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |