C25H33N3O2 — CID 110064519
3-methyl-15-(1-methylpiperidin-4-yl)-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one (PubChem CID 110064519) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 3-methyl-15-(1-methylpiperidin-4-yl)-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one.
| Compound Name | 3-methyl-15-(1-methylpiperidin-4-yl)-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one |
|---|---|
| PubChem CID | 110064519 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 3-methyl-15-(1-methylpiperidin-4-yl)-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one |
| SMILES | CN1CCC(N2CCCOc3ccccc3C(=O)N(C)Cc3cccc(c3)C2)CC1 |
| InChI | InChI=1S/C25H33N3O2/c1-26-14-11-22(12-15-26)28-13-6-16-30-24-10-4-3-9-23(24)25(29)27(2)18-20-7-5-8-21(17-20)19-28/h3-5,7-10,17,22H,6,11-16,18-19H2,1-2H3 |
| InChIKey | UQGOEFJMPKPHKC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |