C26H38N6O3 — CID 110064525
2-(7-oxospiro[2-oxa-6-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-8,4'-piperidine]-1'-yl)-N-[3-(1,2,4-triazol-1-yl)propyl]acetamide (PubChem CID 110064525) has the molecular formula C26H38N6O3 and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-(7-oxospiro[2-oxa-6-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-8,4'-piperidine]-1'-yl)-N-[3-(1,2,4-triazol-1-yl)propyl]acetamide.
| Compound Name | 2-(7-oxospiro[2-oxa-6-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-8,4'-piperidine]-1'-yl)-N-[3-(1,2,4-triazol-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 110064525 |
| Molecular Formula | C26H38N6O3 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 2-(7-oxospiro[2-oxa-6-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-8,4'-piperidine]-1'-yl)-N-[3-(1,2,4-triazol-1-yl)propyl]acetamide |
| SMILES | O=C(CN1CCC2(CCCCc3ccccc3OCCCNC2=O)CC1)NCCCn1cncn1 |
| InChI | InChI=1S/C26H38N6O3/c33-24(28-13-5-15-32-21-27-20-30-32)19-31-16-11-26(12-17-31)10-4-3-8-22-7-1-2-9-23(22)35-18-6-14-29-25(26)34/h1-2,7,9,20-21H,3-6,8,10-19H2,(H,28,33)(H,29,34) |
| InChIKey | PGMDKXKBHDARDQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|