C25H37N5O2 — CID 110065048
1'-[(4-propan-2-ylphenyl)methyl]spiro[11-oxa-1,8,14,15-tetrazabicyclo[11.2.1]hexadeca-13(16),14-diene-6,4'-piperidine]-7-one (PubChem CID 110065048) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 1'-[(4-propan-2-ylphenyl)methyl]spiro[11-oxa-1,8,14,15-tetrazabicyclo[11.2.1]hexadeca-13(16),14-diene-6,4'-piperidine]-7-one.
| Compound Name | 1'-[(4-propan-2-ylphenyl)methyl]spiro[11-oxa-1,8,14,15-tetrazabicyclo[11.2.1]hexadeca-13(16),14-diene-6,4'-piperidine]-7-one |
|---|---|
| PubChem CID | 110065048 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 1'-[(4-propan-2-ylphenyl)methyl]spiro[11-oxa-1,8,14,15-tetrazabicyclo[11.2.1]hexadeca-13(16),14-diene-6,4'-piperidine]-7-one |
| SMILES | CC(C)c1ccc(CN2CCC3(CCCCn4cc(nn4)COCCNC3=O)CC2)cc1 |
| InChI | InChI=1S/C25H37N5O2/c1-20(2)22-7-5-21(6-8-22)17-29-14-10-25(11-15-29)9-3-4-13-30-18-23(27-28-30)19-32-16-12-26-24(25)31/h5-8,18,20H,3-4,9-17,19H2,1-2H3,(H,26,31) |
| InChIKey | UVBWXAGSJCTWAP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |