C27H30F3N5O — CID 110065716
1-[(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanone (PubChem CID 110065716) has the molecular formula C27H30F3N5O and a molecular weight of 497.57 g/mol. Its IUPAC name is 1-[(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanone.
| Compound Name | 1-[(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 110065716 |
| Molecular Formula | C27H30F3N5O |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 1-[(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanone |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)N1Cc2ccccc2NCC[C@@H]2CC[C@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C27H30F3N5O/c28-27(29,30)25-13-15-34(32-25)19-26(36)33-17-21-8-4-5-9-24(21)31-14-12-22-10-11-23(18-33)35(22)16-20-6-2-1-3-7-20/h1-9,13,15,22-23,31H,10-12,14,16-19H2/t22-,23+/m0/s1 |
| InChIKey | LUDONFMXWXJTJA-XZOQPEGZSA-N |
| XLogP | 4.78 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |