C32H38N4O3 — CID 110066020
15-methyl-12-[2-(1-methylpiperidin-4-yl)acetyl]-5-pyridin-3-yl-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one (PubChem CID 110066020) has the molecular formula C32H38N4O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is 15-methyl-12-[2-(1-methylpiperidin-4-yl)acetyl]-5-pyridin-3-yl-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one.
| Compound Name | 15-methyl-12-[2-(1-methylpiperidin-4-yl)acetyl]-5-pyridin-3-yl-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one |
|---|---|
| PubChem CID | 110066020 |
| Molecular Formula | C32H38N4O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 15-methyl-12-[2-(1-methylpiperidin-4-yl)acetyl]-5-pyridin-3-yl-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one |
| SMILES | CN1CCC(CC(=O)N2CCOc3ccc(-c4cccnc4)cc3Cc3cccc(c3)C(=O)N(C)CC2)CC1 |
| InChI | InChI=1S/C32H38N4O3/c1-34-13-10-24(11-14-34)21-31(37)36-16-15-35(2)32(38)27-6-3-5-25(19-27)20-29-22-26(28-7-4-12-33-23-28)8-9-30(29)39-18-17-36/h3-9,12,19,22-24H,10-11,13-18,20-21H2,1-2H3 |
| InChIKey | IBHAMPIWSSUCPO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |