C28H36N6O2 — CID 110066372
1-[5-(pyridin-4-ylmethyl)spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-1'-yl]-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 110066372) has the molecular formula C28H36N6O2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 1-[5-(pyridin-4-ylmethyl)spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-1'-yl]-2-(1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-[5-(pyridin-4-ylmethyl)spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-1'-yl]-2-(1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 110066372 |
| Molecular Formula | C28H36N6O2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 1-[5-(pyridin-4-ylmethyl)spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-1'-yl]-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(Cn1cncn1)N1CCC2(CCCCc3ccccc3OCCN(Cc3ccncc3)C2)CC1 |
| InChI | InChI=1S/C28H36N6O2/c35-27(20-34-23-30-22-31-34)33-15-11-28(12-16-33)10-4-3-6-25-5-1-2-7-26(25)36-18-17-32(21-28)19-24-8-13-29-14-9-24/h1-2,5,7-9,13-14,22-23H,3-4,6,10-12,15-21H2 |
| InChIKey | TUFYVYLAJVNDFE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |