C34H39ClN4O4 — CID 110066530
6-chloro-12-[[4-propan-2-yloxy-3-(pyrazol-1-ylmethyl)phenyl]methyl]-2,19-dioxa-9,12-diazatricyclo[18.4.0.03,8]tetracosa-1(24),3(8),4,6,20,22-hexaen-10-one (PubChem CID 110066530) has the molecular formula C34H39ClN4O4 and a molecular weight of 603.16 g/mol. Its IUPAC name is 6-chloro-12-[[4-propan-2-yloxy-3-(pyrazol-1-ylmethyl)phenyl]methyl]-2,19-dioxa-9,12-diazatricyclo[18.4.0.03,8]tetracosa-1(24),3(8),4,6,20,22-hexaen-10-one.
| Compound Name | 6-chloro-12-[[4-propan-2-yloxy-3-(pyrazol-1-ylmethyl)phenyl]methyl]-2,19-dioxa-9,12-diazatricyclo[18.4.0.03,8]tetracosa-1(24),3(8),4,6,20,22-hexaen-10-one |
|---|---|
| PubChem CID | 110066530 |
| Molecular Formula | C34H39ClN4O4 |
| Molecular Weight | 603.16 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 6-chloro-12-[[4-propan-2-yloxy-3-(pyrazol-1-ylmethyl)phenyl]methyl]-2,19-dioxa-9,12-diazatricyclo[18.4.0.03,8]tetracosa-1(24),3(8),4,6,20,22-hexaen-10-one |
| SMILES | CC(C)Oc1ccc(CN2CCCCCCOc3ccccc3Oc3ccc(Cl)cc3NC(=O)C2)cc1Cn1cccn1 |
| InChI | InChI=1S/C34H39ClN4O4/c1-25(2)42-30-14-12-26(20-27(30)23-39-18-9-16-36-39)22-38-17-7-3-4-8-19-41-32-10-5-6-11-33(32)43-31-15-13-28(35)21-29(31)37-34(40)24-38/h5-6,9-16,18,20-21,25H,3-4,7-8,17,19,22-24H2,1-2H3,(H,37,40) |
| InChIKey | GMIAGMUVYVMINX-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.16 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |