C34H46FNO9 — CID 11006719
[(2S,3S,4R,5R)-5-[[(2R,3R,4R)-4-fluoro-3-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate (PubChem CID 11006719) has the molecular formula C34H46FNO9 and a molecular weight of 631.74 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[[(2R,3R,4R)-4-fluoro-3-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate.
| Compound Name | [(2S,3S,4R,5R)-5-[[(2R,3R,4R)-4-fluoro-3-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 11006719 |
| Molecular Formula | C34H46FNO9 |
| Molecular Weight | 631.74 g/mol |
| Exact Mass | 631.32 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[[(2R,3R,4R)-4-fluoro-3-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate |
| SMILES | COC(=O)CCCCCCCCO[C@H]1O[C@H](CN2C[C@@H](F)[C@H](O)[C@H]2CO)[C@@H](OCc2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H46FNO9/c1-41-29(38)18-12-4-2-3-5-13-19-42-34-32(45-33(40)25-16-10-7-11-17-25)31(43-23-24-14-8-6-9-15-24)28(44-34)21-36-20-26(35)30(39)27(36)22-37/h6-11,14-17,26-28,30-32,34,37,39H,2-5,12-13,18-23H2,1H3/t26-,27-,28-,30+,31-,32+,34+/m1/s1 |
| InChIKey | XNUZYKSNKZSDSN-OOFZQWNLSA-N |
| XLogP | 3.82 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.74 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|