C36H52N2O4Si2 — CID 11006726
benzhydryl 5-[(3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]piperidin-1-yl]pyridine-2-carboxylate (PubChem CID 11006726) has the molecular formula C36H52N2O4Si2 and a molecular weight of 632.99 g/mol. Its IUPAC name is benzhydryl 5-[(3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]piperidin-1-yl]pyridine-2-carboxylate.
| Compound Name | benzhydryl 5-[(3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]piperidin-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 11006726 |
| Molecular Formula | C36H52N2O4Si2 |
| Molecular Weight | 632.99 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | benzhydryl 5-[(3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]piperidin-1-yl]pyridine-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCN(c2ccc(C(=O)OC(c3ccccc3)c3ccccc3)nc2)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H52N2O4Si2/c1-35(2,3)43(7,8)41-31-23-24-38(26-32(31)42-44(9,10)36(4,5)6)29-21-22-30(37-25-29)34(39)40-33(27-17-13-11-14-18-27)28-19-15-12-16-20-28/h11-22,25,31-33H,23-24,26H2,1-10H3/t31-,32-/m0/s1 |
| InChIKey | BXJNZRQVBOHHBT-ACHIHNKUSA-N |
| XLogP | 9.02 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.99 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|