C22H24N4O2S — CID 110067287
N-(4-methyl-1,3-thiazol-2-yl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaen-9-amine (PubChem CID 110067287) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaen-9-amine.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaen-9-amine |
|---|---|
| PubChem CID | 110067287 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaen-9-amine |
| SMILES | Cc1csc(N/C2=N\CCCCCCOc3ccccc3Oc3ncccc32)n1 |
| InChI | InChI=1S/C22H24N4O2S/c1-16-15-29-22(25-16)26-20-17-9-8-13-24-21(17)28-19-11-5-4-10-18(19)27-14-7-3-2-6-12-23-20/h4-5,8-11,13,15H,2-3,6-7,12,14H2,1H3,(H,23,25,26) |
| InChIKey | BLEFTCOKKJTFDV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |