C31H37N3O4 — CID 110067721
2-(11-benzyl-9-oxo-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)-N-(2-phenoxyethyl)acetamide (PubChem CID 110067721) has the molecular formula C31H37N3O4 and a molecular weight of 515.65 g/mol. Its IUPAC name is 2-(11-benzyl-9-oxo-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-(11-benzyl-9-oxo-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 110067721 |
| Molecular Formula | C31H37N3O4 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | 2-(11-benzyl-9-oxo-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)-N-(2-phenoxyethyl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)CN(Cc1ccccc1)CC(=O)NCCCCCO2)NCCOc1ccccc1 |
| InChI | InChI=1S/C31H37N3O4/c35-30(33-17-19-37-28-12-6-2-7-13-28)21-26-14-15-29-27(20-26)23-34(22-25-10-4-1-5-11-25)24-31(36)32-16-8-3-9-18-38-29/h1-2,4-7,10-15,20H,3,8-9,16-19,21-24H2,(H,32,36)(H,33,35) |
| InChIKey | PPCFFMYLEOZYPP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|