C25H27N3O5 — CID 110068033
N-[(3,5-dimethoxyphenyl)methyl]-2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,9,17,19-heptaen-9-amine (PubChem CID 110068033) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,9,17,19-heptaen-9-amine.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,9,17,19-heptaen-9-amine |
|---|---|
| PubChem CID | 110068033 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-2,13,16-trioxa-4,10-diazatricyclo[15.4.0.03,8]henicosa-1(21),3(8),4,6,9,17,19-heptaen-9-amine |
| SMILES | COc1cc(CN/C2=N\CCOCCOc3ccccc3Oc3ncccc32)cc(OC)c1 |
| InChI | InChI=1S/C25H27N3O5/c1-29-19-14-18(15-20(16-19)30-2)17-28-24-21-6-5-9-27-25(21)33-23-8-4-3-7-22(23)32-13-12-31-11-10-26-24/h3-9,14-16H,10-13,17H2,1-2H3,(H,26,28) |
| InChIKey | LAWGESSTNDJANV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |