C33H40N4O3 — CID 110071085
2-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)-N-[2-(1,2,6-trimethylindol-3-yl)ethyl]acetamide (PubChem CID 110071085) has the molecular formula C33H40N4O3 and a molecular weight of 540.71 g/mol. Its IUPAC name is 2-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)-N-[2-(1,2,6-trimethylindol-3-yl)ethyl]acetamide.
| Compound Name | 2-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)-N-[2-(1,2,6-trimethylindol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 110071085 |
| Molecular Formula | C33H40N4O3 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 2-(2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl)-N-[2-(1,2,6-trimethylindol-3-yl)ethyl]acetamide |
| SMILES | Cc1ccc2c(CCNC(=O)CN3CCCCCCOc4ccccc4Oc4ncccc4C3)c(C)n(C)c2c1 |
| InChI | InChI=1S/C33H40N4O3/c1-24-14-15-28-27(25(2)36(3)29(28)21-24)16-18-34-32(38)23-37-19-8-4-5-9-20-39-30-12-6-7-13-31(30)40-33-26(22-37)11-10-17-35-33/h6-7,10-15,17,21H,4-5,8-9,16,18-20,22-23H2,1-3H3,(H,34,38) |
| InChIKey | HMTOYMNGVPUREL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|