C44H52N2O8 — CID 11007120
bis[4-[(2S,3R,4R)-2-(hydroxymethyl)-5-oxo-4-propan-2-ylpyrrolidin-3-yl]naphthalen-1-yl] octanedioate (PubChem CID 11007120) has the molecular formula C44H52N2O8 and a molecular weight of 736.91 g/mol. Its IUPAC name is bis[4-[(2S,3R,4R)-2-(hydroxymethyl)-5-oxo-4-propan-2-ylpyrrolidin-3-yl]naphthalen-1-yl] octanedioate.
| Compound Name | bis[4-[(2S,3R,4R)-2-(hydroxymethyl)-5-oxo-4-propan-2-ylpyrrolidin-3-yl]naphthalen-1-yl] octanedioate |
|---|---|
| PubChem CID | 11007120 |
| Molecular Formula | C44H52N2O8 |
| Molecular Weight | 736.91 g/mol |
| Exact Mass | 736.37 |
| IUPAC Name | bis[4-[(2S,3R,4R)-2-(hydroxymethyl)-5-oxo-4-propan-2-ylpyrrolidin-3-yl]naphthalen-1-yl] octanedioate |
| SMILES | CC(C)[C@H]1C(=O)N[C@H](CO)[C@H]1c1ccc(OC(=O)CCCCCCC(=O)Oc2ccc([C@H]3[C@@H](C(C)C)C(=O)N[C@@H]3CO)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C44H52N2O8/c1-25(2)39-41(33(23-47)45-43(39)51)31-19-21-35(29-15-11-9-13-27(29)31)53-37(49)17-7-5-6-8-18-38(50)54-36-22-20-32(28-14-10-12-16-30(28)36)42-34(24-48)46-44(52)40(42)26(3)4/h9-16,19-22,25-26,33-34,39-42,47-48H,5-8,17-18,23-24H2,1-4H3,(H,45,51)(H,46,52)/t33-,34-,39-,40-,41-,42-/m1/s1 |
| InChIKey | XRTLJGYINIGJQB-NJPLLRKJSA-N |
| XLogP | 6.54 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.91 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|