C24H26N4O3 — CID 110071930
2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl-(5-methylpyrazin-2-yl)methanone (PubChem CID 110071930) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl-(5-methylpyrazin-2-yl)methanone.
| Compound Name | 2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl-(5-methylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 110071930 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,18,20-hexaen-10-yl-(5-methylpyrazin-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)N2CCCCCCOc3ccccc3Oc3ncccc3C2)cn1 |
| InChI | InChI=1S/C24H26N4O3/c1-18-15-27-20(16-26-18)24(29)28-13-6-2-3-7-14-30-21-10-4-5-11-22(21)31-23-19(17-28)9-8-12-25-23/h4-5,8-12,15-16H,2-3,6-7,13-14,17H2,1H3 |
| InChIKey | HTFDHLDCBDZVIJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |