C46H55NO9 — CID 11007204
tert-butyl (4R)-2,2-dimethyl-4-[2-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 11007204) has the molecular formula C46H55NO9 and a molecular weight of 765.94 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[2-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[2-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11007204 |
| Molecular Formula | C46H55NO9 |
| Molecular Weight | 765.94 g/mol |
| Exact Mass | 765.39 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[2-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](C(=O)C[C@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)COC1(C)C |
| InChI | InChI=1S/C46H55NO9/c1-45(2,3)56-44(49)47-37(31-54-46(47,4)5)38(48)26-39-41(51-28-34-20-12-7-13-21-34)43(53-30-36-24-16-9-17-25-36)42(52-29-35-22-14-8-15-23-35)40(55-39)32-50-27-33-18-10-6-11-19-33/h6-25,37,39-43H,26-32H2,1-5H3/t37-,39-,40-,41+,42+,43-/m1/s1 |
| InChIKey | RPNBXSBDNGQODM-PCTNHWSJSA-N |
| XLogP | 8.06 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.94 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |