C26H37N5O3 — CID 110073158
(4S)-4-(2-methylpropyl)-1'-[2-(1,2,4-triazol-1-yl)acetyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-6-one (PubChem CID 110073158) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is (4S)-4-(2-methylpropyl)-1'-[2-(1,2,4-triazol-1-yl)acetyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-6-one.
| Compound Name | (4S)-4-(2-methylpropyl)-1'-[2-(1,2,4-triazol-1-yl)acetyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-6-one |
|---|---|
| PubChem CID | 110073158 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | (4S)-4-(2-methylpropyl)-1'-[2-(1,2,4-triazol-1-yl)acetyl]spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-6-one |
| SMILES | CC(C)C[C@H]1COc2ccccc2CCCCC2(CCN(C(=O)Cn3cncn3)CC2)C(=O)N1 |
| InChI | InChI=1S/C26H37N5O3/c1-20(2)15-22-17-34-23-9-4-3-7-21(23)8-5-6-10-26(25(33)29-22)11-13-30(14-12-26)24(32)16-31-19-27-18-28-31/h3-4,7,9,18-20,22H,5-6,8,10-17H2,1-2H3,(H,29,33)/t22-/m0/s1 |
| InChIKey | SJXZYMSGHMBUBP-QFIPXVFZSA-N |
| XLogP | 3.22 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |