C24H33F3N2O4 — CID 110073167
12-methyl-1'-(4,4,4-trifluorobutanoyl)spiro[2,9-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-4,4'-piperidine]-13-one (PubChem CID 110073167) has the molecular formula C24H33F3N2O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 12-methyl-1'-(4,4,4-trifluorobutanoyl)spiro[2,9-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-4,4'-piperidine]-13-one.
| Compound Name | 12-methyl-1'-(4,4,4-trifluorobutanoyl)spiro[2,9-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-4,4'-piperidine]-13-one |
|---|---|
| PubChem CID | 110073167 |
| Molecular Formula | C24H33F3N2O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 12-methyl-1'-(4,4,4-trifluorobutanoyl)spiro[2,9-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-4,4'-piperidine]-13-one |
| SMILES | CN1CCOCCCCC2(CCN(C(=O)CCC(F)(F)F)CC2)COc2ccccc2C1=O |
| InChI | InChI=1S/C24H33F3N2O4/c1-28-15-17-32-16-5-4-9-23(18-33-20-7-3-2-6-19(20)22(28)31)11-13-29(14-12-23)21(30)8-10-24(25,26)27/h2-3,6-7H,4-5,8-18H2,1H3 |
| InChIKey | JZOQDEIDLFLRCB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |