C26H34F2N4O2 — CID 110073686
1-[10-[3-(dimethylamino)benzoyl]-14,15-difluoro-6-methyl-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]propan-1-one (PubChem CID 110073686) has the molecular formula C26H34F2N4O2 and a molecular weight of 472.58 g/mol. Its IUPAC name is 1-[10-[3-(dimethylamino)benzoyl]-14,15-difluoro-6-methyl-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]propan-1-one.
| Compound Name | 1-[10-[3-(dimethylamino)benzoyl]-14,15-difluoro-6-methyl-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]propan-1-one |
|---|---|
| PubChem CID | 110073686 |
| Molecular Formula | C26H34F2N4O2 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 1-[10-[3-(dimethylamino)benzoyl]-14,15-difluoro-6-methyl-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]propan-1-one |
| SMILES | CCC(=O)N1CCCN(C)CCCN(C(=O)c2cccc(N(C)C)c2)Cc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C26H34F2N4O2/c1-5-25(33)32-14-8-12-30(4)11-7-13-31(18-20-16-22(27)23(28)17-24(20)32)26(34)19-9-6-10-21(15-19)29(2)3/h6,9-10,15-17H,5,7-8,11-14,18H2,1-4H3 |
| InChIKey | ICCMEGDVYQODBC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |