C24H45N3O3 — CID 110073839
(9S)-9-(2-methylpropyl)-3-pentyl-15-oxa-3,8,11-triazaspiro[5.13]nonadecane-7,10-dione (PubChem CID 110073839) has the molecular formula C24H45N3O3 and a molecular weight of 423.64 g/mol. Its IUPAC name is (9S)-9-(2-methylpropyl)-3-pentyl-15-oxa-3,8,11-triazaspiro[5.13]nonadecane-7,10-dione.
| Compound Name | (9S)-9-(2-methylpropyl)-3-pentyl-15-oxa-3,8,11-triazaspiro[5.13]nonadecane-7,10-dione |
|---|---|
| PubChem CID | 110073839 |
| Molecular Formula | C24H45N3O3 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.35 |
| IUPAC Name | (9S)-9-(2-methylpropyl)-3-pentyl-15-oxa-3,8,11-triazaspiro[5.13]nonadecane-7,10-dione |
| SMILES | CCCCCN1CCC2(CCCCOCCCNC(=O)[C@H](CC(C)C)NC2=O)CC1 |
| InChI | InChI=1S/C24H45N3O3/c1-4-5-7-14-27-15-11-24(12-16-27)10-6-8-17-30-18-9-13-25-22(28)21(19-20(2)3)26-23(24)29/h20-21H,4-19H2,1-3H3,(H,25,28)(H,26,29)/t21-/m0/s1 |
| InChIKey | RCKHLNRRNRIOBB-NRFANRHFSA-N |
| XLogP | 3.50 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|