C37H43N5O5 — CID 110074103
2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-pyridin-3-yloxyphenyl)acetamide (PubChem CID 110074103) has the molecular formula C37H43N5O5 and a molecular weight of 637.78 g/mol. Its IUPAC name is 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-pyridin-3-yloxyphenyl)acetamide.
| Compound Name | 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-pyridin-3-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 110074103 |
| Molecular Formula | C37H43N5O5 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.33 |
| IUPAC Name | 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-pyridin-3-yloxyphenyl)acetamide |
| SMILES | O=C(CN1CC[C@H]2NC(=O)[C@@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@H]2C1)CCOCC3)Nc1ccc(Oc2cccnc2)cc1 |
| InChI | InChI=1S/C37H43N5O5/c43-34(39-29-11-13-30(14-12-29)47-31-10-6-19-38-24-31)26-42-20-15-32-28(25-42)9-4-5-16-37(17-21-46-22-18-37)36(45)41-33(35(44)40-32)23-27-7-2-1-3-8-27/h1-8,10-14,19,24,28,32-33H,9,15-18,20-23,25-26H2,(H,39,43)(H,40,44)(H,41,45)/b5-4+/t28-,32+,33+/m0/s1 |
| InChIKey | JILQNIKIJYEBDD-CBQUSLNASA-N |
| XLogP | 4.49 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|