C48H100O6Si4 — CID 11007451
(3R,5S,8R,9S,10R,12S)-5-hydroxy-3,10-dimethyl-12-triethylsilyloxy-3,8,9-tris[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one (PubChem CID 11007451) has the molecular formula C48H100O6Si4 and a molecular weight of 885.67 g/mol. Its IUPAC name is (3R,5S,8R,9S,10R,12S)-5-hydroxy-3,10-dimethyl-12-triethylsilyloxy-3,8,9-tris[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one.
| Compound Name | (3R,5S,8R,9S,10R,12S)-5-hydroxy-3,10-dimethyl-12-triethylsilyloxy-3,8,9-tris[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one |
|---|---|
| PubChem CID | 11007451 |
| Molecular Formula | C48H100O6Si4 |
| Molecular Weight | 885.67 g/mol |
| Exact Mass | 884.66 |
| IUPAC Name | (3R,5S,8R,9S,10R,12S)-5-hydroxy-3,10-dimethyl-12-triethylsilyloxy-3,8,9-tris[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one |
| SMILES | C#C[C@@](C)(C[C@H](O)CC(=O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C[C@H](C)O[Si](CC)(CC)CC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C48H100O6Si4/c1-26-48(25,54-58(39(17)18,40(19)20)41(21)22)32-44(49)31-45(50)47(53-57(36(11)12,37(13)14)38(15)16)46(52-56(33(5)6,34(7)8)35(9)10)42(23)30-43(24)51-55(27-2,28-3)29-4/h1,33-44,46-47,49H,27-32H2,2-25H3/t42-,43+,44-,46+,47+,48+/m1/s1 |
| InChIKey | VOYXTHJGEZOBBK-RKACLUKLSA-N |
| XLogP | 14.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.67 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|