C24H35N5O — CID 110075360
[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]-[(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone (PubChem CID 110075360) has the molecular formula C24H35N5O and a molecular weight of 409.58 g/mol. Its IUPAC name is [1-methyl-3-(2-methylpropyl)pyrazol-5-yl]-[(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone.
| Compound Name | [1-methyl-3-(2-methylpropyl)pyrazol-5-yl]-[(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone |
|---|---|
| PubChem CID | 110075360 |
| Molecular Formula | C24H35N5O |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | [1-methyl-3-(2-methylpropyl)pyrazol-5-yl]-[(1R,14S)-17-methyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]methanone |
| SMILES | CC(C)Cc1cc(C(=O)N2Cc3ccccc3NCC[C@@H]3CC[C@H](C2)N3C)n(C)n1 |
| InChI | InChI=1S/C24H35N5O/c1-17(2)13-19-14-23(28(4)26-19)24(30)29-15-18-7-5-6-8-22(18)25-12-11-20-9-10-21(16-29)27(20)3/h5-8,14,17,20-21,25H,9-13,15-16H2,1-4H3/t20-,21+/m0/s1 |
| InChIKey | JWRPKZLKMJLVPF-LEWJYISDSA-N |
| XLogP | 3.54 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |