C34H49N3O4 — CID 110075486
1-[2-(cyclohexanecarbonyl)-15-methyl-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl]-3-(3,4-dimethoxyphenyl)propan-1-one (PubChem CID 110075486) has the molecular formula C34H49N3O4 and a molecular weight of 563.78 g/mol. Its IUPAC name is 1-[2-(cyclohexanecarbonyl)-15-methyl-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl]-3-(3,4-dimethoxyphenyl)propan-1-one.
| Compound Name | 1-[2-(cyclohexanecarbonyl)-15-methyl-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl]-3-(3,4-dimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 110075486 |
| Molecular Formula | C34H49N3O4 |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.37 |
| IUPAC Name | 1-[2-(cyclohexanecarbonyl)-15-methyl-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl]-3-(3,4-dimethoxyphenyl)propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2CCN(C(C)C)CCCN(C(=O)C3CCCCC3)c3c(C)cccc3C2)cc1OC |
| InChI | InChI=1S/C34H49N3O4/c1-25(2)35-19-10-20-37(34(39)28-12-7-6-8-13-28)33-26(3)11-9-14-29(33)24-36(22-21-35)32(38)18-16-27-15-17-30(40-4)31(23-27)41-5/h9,11,14-15,17,23,25,28H,6-8,10,12-13,16,18-22,24H2,1-5H3 |
| InChIKey | YVPXDUKBPFUMCD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |