C30H32FN3O — CID 110076181
[(1S,2S,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-[6-[(2-fluorophenyl)methyl]-2-pyridinyl]methanone (PubChem CID 110076181) has the molecular formula C30H32FN3O and a molecular weight of 469.60 g/mol. Its IUPAC name is [(1S,2S,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-[6-[(2-fluorophenyl)methyl]-2-pyridinyl]methanone.
| Compound Name | [(1S,2S,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-[6-[(2-fluorophenyl)methyl]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 110076181 |
| Molecular Formula | C30H32FN3O |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | [(1S,2S,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-[6-[(2-fluorophenyl)methyl]-2-pyridinyl]methanone |
| SMILES | C[C@]12C[C@@H]3N[C@H]1CCC[C@H]2N(C(=O)c1cccc(Cc2ccccc2F)n1)[C@H]3Cc1ccccc1 |
| InChI | InChI=1S/C30H32FN3O/c1-30-19-25-26(17-20-9-3-2-4-10-20)34(28(30)16-8-15-27(30)33-25)29(35)24-14-7-12-22(32-24)18-21-11-5-6-13-23(21)31/h2-7,9-14,25-28,33H,8,15-19H2,1H3/t25-,26-,27-,28+,30-/m0/s1 |
| InChIKey | VAQQKLVKMPNSSA-UFEOFEBPSA-N |
| XLogP | 5.17 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |