C26H24Cl2FNO2 — CID 110076235
N-[(2S,6R)-2,6-bis(4-chlorophenyl)-4-methyloxan-4-yl]-2-(4-fluorophenyl)acetamide (PubChem CID 110076235) has the molecular formula C26H24Cl2FNO2 and a molecular weight of 472.39 g/mol. Its IUPAC name is N-[(2S,6R)-2,6-bis(4-chlorophenyl)-4-methyloxan-4-yl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(2S,6R)-2,6-bis(4-chlorophenyl)-4-methyloxan-4-yl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 110076235 |
| Molecular Formula | C26H24Cl2FNO2 |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[(2S,6R)-2,6-bis(4-chlorophenyl)-4-methyloxan-4-yl]-2-(4-fluorophenyl)acetamide |
| SMILES | CC1(NC(=O)Cc2ccc(F)cc2)C[C@@H](c2ccc(Cl)cc2)O[C@@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H24Cl2FNO2/c1-26(30-25(31)14-17-2-12-22(29)13-3-17)15-23(18-4-8-20(27)9-5-18)32-24(16-26)19-6-10-21(28)11-7-19/h2-13,23-24H,14-16H2,1H3,(H,30,31)/t23-,24+,26? |
| InChIKey | SYQCTDKRTBEDQY-MAOIWGCQSA-N |
| XLogP | 6.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |