About (3S)-1,3-dihydroxybutan-2-one
(3S)-1,3-dihydroxybutan-2-one (PubChem CID 11007836) has the molecular formula C4H8O3
and a molecular weight of 104.11 g/mol. Its IUPAC name is (3S)-1,3-dihydroxybutan-2-one.
Molecular Properties
| Compound Name | (3S)-1,3-dihydroxybutan-2-one |
| PubChem CID | 11007836 |
| Molecular Formula | C4H8O3 |
| Molecular Weight | 104.11 g/mol |
| Exact Mass | 104.05 |
| IUPAC Name | (3S)-1,3-dihydroxybutan-2-one |
| SMILES | C[C@H](O)C(=O)CO |
| InChI | InChI=1S/C4H8O3/c1-3(6)4(7)2-5/h3,5-6H,2H2,1H3/t3-/m0/s1 |
| InChIKey | KXZUWTXQPYQEFV-VKHMYHEASA-N |
| XLogP | -1.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.11 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1,3-dihydroxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,3-dihydroxybutan-2-one?
The IUPAC name of (3S)-1,3-dihydroxybutan-2-one (CID 11007836) is (3S)-1,3-dihydroxybutan-2-one.
What is the SMILES notation for (3S)-1,3-dihydroxybutan-2-one?
The canonical SMILES for (3S)-1,3-dihydroxybutan-2-one is C[C@H](O)C(=O)CO.
What is the InChIKey of (3S)-1,3-dihydroxybutan-2-one?
The InChIKey is KXZUWTXQPYQEFV-VKHMYHEASA-N. The full InChI is InChI=1S/C4H8O3/c1-3(6)4(7)2-5/h3,5-6H,2H2,1H3/t3-/m0/s1.
What are the key properties of (3S)-1,3-dihydroxybutan-2-one?
(3S)-1,3-dihydroxybutan-2-one has a molecular weight of 104.11 g/mol, XLogP of -1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,3-dihydroxybutan-2-one is sourced from PubChem (CID 11007836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).