About (E)-2,4-dimethylpent-2-enal
(E)-2,4-dimethylpent-2-enal (PubChem CID 11007851) has the molecular formula C7H12O
and a molecular weight of 112.17 g/mol. Its IUPAC name is (E)-2,4-dimethylpent-2-enal.
Molecular Properties
| Compound Name | (E)-2,4-dimethylpent-2-enal |
| PubChem CID | 11007851 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | (E)-2,4-dimethylpent-2-enal |
| SMILES | C/C(C=O)=C\C(C)C |
| InChI | InChI=1S/C7H12O/c1-6(2)4-7(3)5-8/h4-6H,1-3H3/b7-4+ |
| InChIKey | SXMYOGGQDRXLAN-QPJJXVBHSA-N |
| XLogP | 1.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,4-dimethylpent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,4-dimethylpent-2-enal?
The IUPAC name of (E)-2,4-dimethylpent-2-enal (CID 11007851) is (E)-2,4-dimethylpent-2-enal.
What is the SMILES notation for (E)-2,4-dimethylpent-2-enal?
The canonical SMILES for (E)-2,4-dimethylpent-2-enal is C/C(C=O)=C\C(C)C.
What is the InChIKey of (E)-2,4-dimethylpent-2-enal?
The InChIKey is SXMYOGGQDRXLAN-QPJJXVBHSA-N. The full InChI is InChI=1S/C7H12O/c1-6(2)4-7(3)5-8/h4-6H,1-3H3/b7-4+.
What are the key properties of (E)-2,4-dimethylpent-2-enal?
(E)-2,4-dimethylpent-2-enal has a molecular weight of 112.17 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,4-dimethylpent-2-enal is sourced from PubChem (CID 11007851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).