About 4-methylmorpholin-3-one
4-methylmorpholin-3-one (PubChem CID 11007867) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is 4-methylmorpholin-3-one.
Molecular Properties
| Compound Name | 4-methylmorpholin-3-one |
| PubChem CID | 11007867 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | 4-methylmorpholin-3-one |
| SMILES | CN1CCOCC1=O |
| InChI | InChI=1S/C5H9NO2/c1-6-2-3-8-4-5(6)7/h2-4H2,1H3 |
| InChIKey | FGQBGDBLZZPFCM-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylmorpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylmorpholin-3-one?
The IUPAC name of 4-methylmorpholin-3-one (CID 11007867) is 4-methylmorpholin-3-one.
What is the SMILES notation for 4-methylmorpholin-3-one?
The canonical SMILES for 4-methylmorpholin-3-one is CN1CCOCC1=O.
What is the InChIKey of 4-methylmorpholin-3-one?
The InChIKey is FGQBGDBLZZPFCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2/c1-6-2-3-8-4-5(6)7/h2-4H2,1H3.
What are the key properties of 4-methylmorpholin-3-one?
4-methylmorpholin-3-one has a molecular weight of 115.13 g/mol, XLogP of -0.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylmorpholin-3-one is sourced from PubChem (CID 11007867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).