About (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one
(4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one (PubChem CID 11007904) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one |
| PubChem CID | 11007904 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one |
| SMILES | CC1(C)C(=O)C=C[C@H]1O |
| InChI | InChI=1S/C7H10O2/c1-7(2)5(8)3-4-6(7)9/h3-5,8H,1-2H3/t5-/m1/s1 |
| InChIKey | KXXNPFCWUOVVNF-RXMQYKEDSA-N |
| XLogP | 0.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one?
The IUPAC name of (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one (CID 11007904) is (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one.
What is the SMILES notation for (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one?
The canonical SMILES for (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one is CC1(C)C(=O)C=C[C@H]1O.
What is the InChIKey of (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one?
The InChIKey is KXXNPFCWUOVVNF-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H10O2/c1-7(2)5(8)3-4-6(7)9/h3-5,8H,1-2H3/t5-/m1/s1.
What are the key properties of (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one?
(4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one has a molecular weight of 126.15 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-one is sourced from PubChem (CID 11007904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).