About 5-ethyl-1-methyl-2,3-dihydropyridin-6-one
5-ethyl-1-methyl-2,3-dihydropyridin-6-one (PubChem CID 11007982) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 5-ethyl-1-methyl-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 5-ethyl-1-methyl-2,3-dihydropyridin-6-one |
| PubChem CID | 11007982 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 5-ethyl-1-methyl-2,3-dihydropyridin-6-one |
| SMILES | CCC1=CCCN(C)C1=O |
| InChI | InChI=1S/C8H13NO/c1-3-7-5-4-6-9(2)8(7)10/h5H,3-4,6H2,1-2H3 |
| InChIKey | NAQGMNFWXYCYRV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-1-methyl-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-methyl-2,3-dihydropyridin-6-one?
The IUPAC name of 5-ethyl-1-methyl-2,3-dihydropyridin-6-one (CID 11007982) is 5-ethyl-1-methyl-2,3-dihydropyridin-6-one.
What is the SMILES notation for 5-ethyl-1-methyl-2,3-dihydropyridin-6-one?
The canonical SMILES for 5-ethyl-1-methyl-2,3-dihydropyridin-6-one is CCC1=CCCN(C)C1=O.
What is the InChIKey of 5-ethyl-1-methyl-2,3-dihydropyridin-6-one?
The InChIKey is NAQGMNFWXYCYRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-3-7-5-4-6-9(2)8(7)10/h5H,3-4,6H2,1-2H3.
What are the key properties of 5-ethyl-1-methyl-2,3-dihydropyridin-6-one?
5-ethyl-1-methyl-2,3-dihydropyridin-6-one has a molecular weight of 139.20 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-methyl-2,3-dihydropyridin-6-one is sourced from PubChem (CID 11007982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).