C21H23ClN2O4 — CID 110079978
2-[(3S,4S)-4-(4-chlorophenoxy)-1-(3-methoxybenzoyl)piperidin-3-yl]acetamide (PubChem CID 110079978) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is 2-[(3S,4S)-4-(4-chlorophenoxy)-1-(3-methoxybenzoyl)piperidin-3-yl]acetamide.
| Compound Name | 2-[(3S,4S)-4-(4-chlorophenoxy)-1-(3-methoxybenzoyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 110079978 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[(3S,4S)-4-(4-chlorophenoxy)-1-(3-methoxybenzoyl)piperidin-3-yl]acetamide |
| SMILES | COc1cccc(C(=O)N2CC[C@H](Oc3ccc(Cl)cc3)[C@@H](CC(N)=O)C2)c1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-27-18-4-2-3-14(11-18)21(26)24-10-9-19(15(13-24)12-20(23)25)28-17-7-5-16(22)6-8-17/h2-8,11,15,19H,9-10,12-13H2,1H3,(H2,23,25)/t15-,19-/m0/s1 |
| InChIKey | PPJDIGARLIFZGZ-KXBFYZLASA-N |
| XLogP | 3.13 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |