About trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate
trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate (PubChem CID 11008032) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate |
| PubChem CID | 11008032 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C7H12O3/c1-10-7(9)5-3-2-4-6(5)8/h5-6,8H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | XMPIOOIEGQJDKJ-PHDIDXHHSA-N |
| XLogP | 0.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate?
The IUPAC name of trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate (CID 11008032) is trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate.
What is the SMILES notation for trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate?
The canonical SMILES for trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate is COC(=O)[C@@H]1CCC[C@H]1O.
What is the InChIKey of trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate?
The InChIKey is XMPIOOIEGQJDKJ-PHDIDXHHSA-N. The full InChI is InChI=1S/C7H12O3/c1-10-7(9)5-3-2-4-6(5)8/h5-6,8H,2-4H2,1H3/t5-,6-/m1/s1.
What are the key properties of trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate?
trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate has a molecular weight of 144.17 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1R,2R)-2-hydroxycyclopentane-1-carboxylate is sourced from PubChem (CID 11008032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).