About 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol
7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol (PubChem CID 11008064) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol.
Molecular Properties
| Compound Name | 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol |
| PubChem CID | 11008064 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol |
| SMILES | C=C1CC(O)c2ccncc21 |
| InChI | InChI=1S/C9H9NO/c1-6-4-9(11)7-2-3-10-5-8(6)7/h2-3,5,9,11H,1,4H2 |
| InChIKey | OUUYAJHMVQSQLP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol?
The IUPAC name of 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol (CID 11008064) is 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol.
What is the SMILES notation for 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol?
The canonical SMILES for 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol is C=C1CC(O)c2ccncc21.
What is the InChIKey of 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol?
The InChIKey is OUUYAJHMVQSQLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c1-6-4-9(11)7-2-3-10-5-8(6)7/h2-3,5,9,11H,1,4H2.
What are the key properties of 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol?
7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol has a molecular weight of 147.18 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylidene-5,6-dihydrocyclopenta[c]pyridin-5-ol is sourced from PubChem (CID 11008064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).