About (3E)-4,8-dimethylnona-3,7-dien-1-yne
(3E)-4,8-dimethylnona-3,7-dien-1-yne (PubChem CID 11008074) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is (3E)-4,8-dimethylnona-3,7-dien-1-yne.
Molecular Properties
| Compound Name | (3E)-4,8-dimethylnona-3,7-dien-1-yne |
| PubChem CID | 11008074 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (3E)-4,8-dimethylnona-3,7-dien-1-yne |
| SMILES | C#C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C11H16/c1-5-7-11(4)9-6-8-10(2)3/h1,7-8H,6,9H2,2-4H3/b11-7+ |
| InChIKey | SJXNBIFDWPOVMU-YRNVUSSQSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4,8-dimethylnona-3,7-dien-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4,8-dimethylnona-3,7-dien-1-yne?
The IUPAC name of (3E)-4,8-dimethylnona-3,7-dien-1-yne (CID 11008074) is (3E)-4,8-dimethylnona-3,7-dien-1-yne.
What is the SMILES notation for (3E)-4,8-dimethylnona-3,7-dien-1-yne?
The canonical SMILES for (3E)-4,8-dimethylnona-3,7-dien-1-yne is C#C/C=C(\C)CCC=C(C)C.
What is the InChIKey of (3E)-4,8-dimethylnona-3,7-dien-1-yne?
The InChIKey is SJXNBIFDWPOVMU-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H16/c1-5-7-11(4)9-6-8-10(2)3/h1,7-8H,6,9H2,2-4H3/b11-7+.
What are the key properties of (3E)-4,8-dimethylnona-3,7-dien-1-yne?
(3E)-4,8-dimethylnona-3,7-dien-1-yne has a molecular weight of 148.25 g/mol, XLogP of 3.31, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4,8-dimethylnona-3,7-dien-1-yne is sourced from PubChem (CID 11008074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).