About Diisoamylborane
Diisoamylborane (PubChem CID 11008130) has the molecular formula C10H22B
and a molecular weight of 153.10 g/mol.
Molecular Properties
| Compound Name | Diisoamylborane |
| PubChem CID | 11008130 |
| Molecular Formula | C10H22B |
| Molecular Weight | 153.10 g/mol |
| Exact Mass | 153.18 |
| IUPAC Name | — |
| SMILES | CC(C)CC[B]CCC(C)C |
| InChI | InChI=1S/C10H22B/c1-9(2)5-7-11-8-6-10(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | RZPSHRCROPCUCY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.10 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Diisoamylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diisoamylborane?
The IUPAC name of Diisoamylborane (CID 11008130) is not available.
What is the SMILES notation for Diisoamylborane?
The canonical SMILES for Diisoamylborane is CC(C)CC[B]CCC(C)C.
What is the InChIKey of Diisoamylborane?
The InChIKey is RZPSHRCROPCUCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22B/c1-9(2)5-7-11-8-6-10(3)4/h9-10H,5-8H2,1-4H3.
What are the key properties of Diisoamylborane?
Diisoamylborane has a molecular weight of 153.10 g/mol, XLogP of 3.62, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Diisoamylborane is sourced from PubChem (CID 11008130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).