C25H29ClN2O4 — CID 110081344
2-[4-benzoyl-2-[(3-chlorophenoxy)methyl]morpholin-2-yl]-1-piperidin-1-ylethanone (PubChem CID 110081344) has the molecular formula C25H29ClN2O4 and a molecular weight of 456.97 g/mol. Its IUPAC name is 2-[4-benzoyl-2-[(3-chlorophenoxy)methyl]morpholin-2-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-benzoyl-2-[(3-chlorophenoxy)methyl]morpholin-2-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 110081344 |
| Molecular Formula | C25H29ClN2O4 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[4-benzoyl-2-[(3-chlorophenoxy)methyl]morpholin-2-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CC1(COc2cccc(Cl)c2)CN(C(=O)c2ccccc2)CCO1)N1CCCCC1 |
| InChI | InChI=1S/C25H29ClN2O4/c26-21-10-7-11-22(16-21)31-19-25(17-23(29)27-12-5-2-6-13-27)18-28(14-15-32-25)24(30)20-8-3-1-4-9-20/h1,3-4,7-11,16H,2,5-6,12-15,17-19H2 |
| InChIKey | AFKCSIVXROLJBI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |