C9H14O2 — CID 11008141
2-cyclopropylidene-5,5-dimethyl-1,3-dioxane (PubChem CID 11008141) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 11008141 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane |
| SMILES | CC1(C)COC(=C2CC2)OC1 |
| InChI | InChI=1S/C9H14O2/c1-9(2)5-10-8(11-6-9)7-3-4-7/h3-6H2,1-2H3 |
| InChIKey | DHDNCKJDISLHFE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |