About 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane
2-cyclopropylidene-5,5-dimethyl-1,3-dioxane (PubChem CID 11008141) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane |
| PubChem CID | 11008141 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane |
| SMILES | CC1(C)COC(=C2CC2)OC1 |
| InChI | InChI=1S/C9H14O2/c1-9(2)5-10-8(11-6-9)7-3-4-7/h3-6H2,1-2H3 |
| InChIKey | DHDNCKJDISLHFE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane?
The IUPAC name of 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane (CID 11008141) is 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane.
What is the SMILES notation for 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane?
The canonical SMILES for 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane is CC1(C)COC(=C2CC2)OC1.
What is the InChIKey of 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane?
The InChIKey is DHDNCKJDISLHFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-9(2)5-10-8(11-6-9)7-3-4-7/h3-6H2,1-2H3.
What are the key properties of 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane?
2-cyclopropylidene-5,5-dimethyl-1,3-dioxane has a molecular weight of 154.21 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylidene-5,5-dimethyl-1,3-dioxane is sourced from PubChem (CID 11008141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).