About ethyl 2-acetamidopropanoate
ethyl 2-acetamidopropanoate (PubChem CID 11008202) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is ethyl 2-acetamidopropanoate.
Molecular Properties
| Compound Name | ethyl 2-acetamidopropanoate |
| PubChem CID | 11008202 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | ethyl 2-acetamidopropanoate |
| SMILES | CCOC(=O)C(C)NC(C)=O |
| InChI | InChI=1S/C7H13NO3/c1-4-11-7(10)5(2)8-6(3)9/h5H,4H2,1-3H3,(H,8,9) |
| InChIKey | BFNYDDPQMKYKKJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-acetamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-acetamidopropanoate?
The IUPAC name of ethyl 2-acetamidopropanoate (CID 11008202) is ethyl 2-acetamidopropanoate.
What is the SMILES notation for ethyl 2-acetamidopropanoate?
The canonical SMILES for ethyl 2-acetamidopropanoate is CCOC(=O)C(C)NC(C)=O.
What is the InChIKey of ethyl 2-acetamidopropanoate?
The InChIKey is BFNYDDPQMKYKKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-4-11-7(10)5(2)8-6(3)9/h5H,4H2,1-3H3,(H,8,9).
What are the key properties of ethyl 2-acetamidopropanoate?
ethyl 2-acetamidopropanoate has a molecular weight of 159.18 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-acetamidopropanoate is sourced from PubChem (CID 11008202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).