C24H28N4O3 — CID 110082676
4-(2,3-dimethylphenoxy)-1-[2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butan-1-one (PubChem CID 110082676) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-(2,3-dimethylphenoxy)-1-[2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butan-1-one.
| Compound Name | 4-(2,3-dimethylphenoxy)-1-[2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 110082676 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 4-(2,3-dimethylphenoxy)-1-[2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butan-1-one |
| SMILES | Cc1cccc(OCCCC(=O)N2CCCCC2c2nnc(-c3cccnc3)o2)c1C |
| InChI | InChI=1S/C24H28N4O3/c1-17-8-5-11-21(18(17)2)30-15-7-12-22(29)28-14-4-3-10-20(28)24-27-26-23(31-24)19-9-6-13-25-16-19/h5-6,8-9,11,13,16,20H,3-4,7,10,12,14-15H2,1-2H3 |
| InChIKey | QZEBLWKQVLFXBT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|