C22H26N6O2 — CID 110083029
5-[1-(1-ethylpyrazole-3-carbonyl)piperidin-3-yl]-N-methyl-N-phenyl-1H-pyrazole-4-carboxamide (PubChem CID 110083029) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 5-[1-(1-ethylpyrazole-3-carbonyl)piperidin-3-yl]-N-methyl-N-phenyl-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[1-(1-ethylpyrazole-3-carbonyl)piperidin-3-yl]-N-methyl-N-phenyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 110083029 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 5-[1-(1-ethylpyrazole-3-carbonyl)piperidin-3-yl]-N-methyl-N-phenyl-1H-pyrazole-4-carboxamide |
| SMILES | CCn1ccc(C(=O)N2CCCC(c3[nH]ncc3C(=O)N(C)c3ccccc3)C2)n1 |
| InChI | InChI=1S/C22H26N6O2/c1-3-28-13-11-19(25-28)22(30)27-12-7-8-16(15-27)20-18(14-23-24-20)21(29)26(2)17-9-5-4-6-10-17/h4-6,9-11,13-14,16H,3,7-8,12,15H2,1-2H3,(H,23,24) |
| InChIKey | LCQGTJZSQQJNKB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|