C8H11ClN2 — CID 11008376
N'-(3-chlorophenyl)ethane-1,2-diamine (PubChem CID 11008376) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is N'-(3-chlorophenyl)ethane-1,2-diamine.
| Compound Name | N'-(3-chlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 11008376 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | N'-(3-chlorophenyl)ethane-1,2-diamine |
| SMILES | NCCNc1cccc(Cl)c1 |
| InChI | InChI=1S/C8H11ClN2/c9-7-2-1-3-8(6-7)11-5-4-10/h1-3,6,11H,4-5,10H2 |
| InChIKey | XLYRTRQTLBKLLD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |