About (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide
(3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide (PubChem CID 11008385) has the molecular formula C9H8N4
and a molecular weight of 172.19 g/mol. Its IUPAC name is (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide.
Molecular Properties
| Compound Name | (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide |
| PubChem CID | 11008385 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide |
| SMILES | Cc1cc(C)c(C#N)c(NC#N)n1 |
| InChI | InChI=1S/C9H8N4/c1-6-3-7(2)13-9(12-5-11)8(6)4-10/h3H,1-2H3,(H,12,13) |
| InChIKey | DJODUGHWQPNEPM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide?
The IUPAC name of (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide (CID 11008385) is (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide.
What is the SMILES notation for (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide?
The canonical SMILES for (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide is Cc1cc(C)c(C#N)c(NC#N)n1.
What is the InChIKey of (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide?
The InChIKey is DJODUGHWQPNEPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4/c1-6-3-7(2)13-9(12-5-11)8(6)4-10/h3H,1-2H3,(H,12,13).
What are the key properties of (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide?
(3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide has a molecular weight of 172.19 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-4,6-dimethyl-2-pyridinyl)cyanamide is sourced from PubChem (CID 11008385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).