C21H30N4O3S — CID 110084250
3-[1-(5-methylthiophene-2-carbonyl)piperidin-4-yl]-8-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 110084250) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 3-[1-(5-methylthiophene-2-carbonyl)piperidin-4-yl]-8-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[1-(5-methylthiophene-2-carbonyl)piperidin-4-yl]-8-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 110084250 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 3-[1-(5-methylthiophene-2-carbonyl)piperidin-4-yl]-8-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCCN1CCC2(CC1)NC(=O)N(C1CCN(C(=O)c3ccc(C)s3)CC1)C2=O |
| InChI | InChI=1S/C21H30N4O3S/c1-3-10-23-13-8-21(9-14-23)19(27)25(20(28)22-21)16-6-11-24(12-7-16)18(26)17-5-4-15(2)29-17/h4-5,16H,3,6-14H2,1-2H3,(H,22,28) |
| InChIKey | NQKQBVSCBGOYJW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|