C19H32N4O3 — CID 110084347
3-[1-(2-methylpropanoyl)piperidin-3-yl]-8-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 110084347) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[1-(2-methylpropanoyl)piperidin-3-yl]-8-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[1-(2-methylpropanoyl)piperidin-3-yl]-8-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 110084347 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 3-[1-(2-methylpropanoyl)piperidin-3-yl]-8-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCCN1CCC2(CC1)NC(=O)N(C1CCCN(C(=O)C(C)C)C1)C2=O |
| InChI | InChI=1S/C19H32N4O3/c1-4-9-21-11-7-19(8-12-21)17(25)23(18(26)20-19)15-6-5-10-22(13-15)16(24)14(2)3/h14-15H,4-13H2,1-3H3,(H,20,26) |
| InChIKey | PZRSEYLUGXXARD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|