C16H25N5O3S — CID 110085045
N-cyclopropyl-4-[1-(dimethylsulfamoyl)piperidin-2-yl]-2-methylpyrimidine-5-carboxamide (PubChem CID 110085045) has the molecular formula C16H25N5O3S and a molecular weight of 367.48 g/mol. Its IUPAC name is N-cyclopropyl-4-[1-(dimethylsulfamoyl)piperidin-2-yl]-2-methylpyrimidine-5-carboxamide.
| Compound Name | N-cyclopropyl-4-[1-(dimethylsulfamoyl)piperidin-2-yl]-2-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110085045 |
| Molecular Formula | C16H25N5O3S |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-cyclopropyl-4-[1-(dimethylsulfamoyl)piperidin-2-yl]-2-methylpyrimidine-5-carboxamide |
| SMILES | Cc1ncc(C(=O)NC2CC2)c(C2CCCCN2S(=O)(=O)N(C)C)n1 |
| InChI | InChI=1S/C16H25N5O3S/c1-11-17-10-13(16(22)19-12-7-8-12)15(18-11)14-6-4-5-9-21(14)25(23,24)20(2)3/h10,12,14H,4-9H2,1-3H3,(H,19,22) |
| InChIKey | PCEHQSCQIZXZSN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |