C14H22 — CID 11008731
(3aS,6aR)-5,6-dimethylspiro[2,3,3a,6a-tetrahydro-1H-pentalene-4,1'-cyclopentane] (PubChem CID 11008731) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (3aS,6aR)-5,6-dimethylspiro[2,3,3a,6a-tetrahydro-1H-pentalene-4,1'-cyclopentane].
| Compound Name | (3aS,6aR)-5,6-dimethylspiro[2,3,3a,6a-tetrahydro-1H-pentalene-4,1'-cyclopentane] |
|---|---|
| PubChem CID | 11008731 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (3aS,6aR)-5,6-dimethylspiro[2,3,3a,6a-tetrahydro-1H-pentalene-4,1'-cyclopentane] |
| SMILES | CC1=C(C)C2(CCCC2)[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C14H22/c1-10-11(2)14(8-3-4-9-14)13-7-5-6-12(10)13/h12-13H,3-9H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | PMGIISZROLJANE-STQMWFEESA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|