About 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne
1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne (PubChem CID 11008822) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne.
Molecular Properties
| Compound Name | 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne |
| PubChem CID | 11008822 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne |
| SMILES | CC(C)(C)OC#CC#COC(C)(C)C |
| InChI | InChI=1S/C12H18O2/c1-11(2,3)13-9-7-8-10-14-12(4,5)6/h1-6H3 |
| InChIKey | OYBUFRYLIMDKDO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne?
The IUPAC name of 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne (CID 11008822) is 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne.
What is the SMILES notation for 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne?
The canonical SMILES for 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne is CC(C)(C)OC#CC#COC(C)(C)C.
What is the InChIKey of 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne?
The InChIKey is OYBUFRYLIMDKDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-11(2,3)13-9-7-8-10-14-12(4,5)6/h1-6H3.
What are the key properties of 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne?
1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne has a molecular weight of 194.27 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diyne is sourced from PubChem (CID 11008822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).