About 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one
5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one (PubChem CID 11008905) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one.
Molecular Properties
| Compound Name | 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one |
| PubChem CID | 11008905 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one |
| SMILES | C=C1C(=O)OC(C(C)C)OC1C(C)C |
| InChI | InChI=1S/C11H18O3/c1-6(2)9-8(5)10(12)14-11(13-9)7(3)4/h6-7,9,11H,5H2,1-4H3 |
| InChIKey | BCEFTGNRRKRKON-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one?
The IUPAC name of 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one (CID 11008905) is 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one.
What is the SMILES notation for 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one?
The canonical SMILES for 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one is C=C1C(=O)OC(C(C)C)OC1C(C)C.
What is the InChIKey of 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one?
The InChIKey is BCEFTGNRRKRKON-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-6(2)9-8(5)10(12)14-11(13-9)7(3)4/h6-7,9,11H,5H2,1-4H3.
What are the key properties of 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one?
5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one has a molecular weight of 198.26 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidene-2,6-di(propan-2-yl)-1,3-dioxan-4-one is sourced from PubChem (CID 11008905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).